C33H36N4O4S — CID 46110405
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(1-phenylethylsulfamoyl)phenyl]-2-phenylacetamide (PubChem CID 46110405) has the molecular formula C33H36N4O4S and a molecular weight of 584.74 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(1-phenylethylsulfamoyl)phenyl]-2-phenylacetamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(1-phenylethylsulfamoyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 46110405 |
| Molecular Formula | C33H36N4O4S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(1-phenylethylsulfamoyl)phenyl]-2-phenylacetamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Cc3ccccc3)cc2S(=O)(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H36N4O4S/c1-25(27-13-7-4-8-14-27)35-42(39,40)32-24-28(34-33(38)23-26-11-5-3-6-12-26)17-18-30(32)37-21-19-36(20-22-37)29-15-9-10-16-31(29)41-2/h3-18,24-25,35H,19-23H2,1-2H3,(H,34,38) |
| InChIKey | TXWFYPUZRCOVKT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|