C29H34N4O3S — CID 93018756
(E)-N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 93018756) has the molecular formula C29H34N4O3S and a molecular weight of 518.68 g/mol. Its IUPAC name is (E)-N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 93018756 |
| Molecular Formula | C29H34N4O3S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | (E)-N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)/C=C/c3ccccc3)cc2S(=O)(=O)N[C@@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H34N4O3S/c1-3-32-18-20-33(21-19-32)27-16-15-26(30-29(34)17-14-24-10-6-4-7-11-24)22-28(27)37(35,36)31-23(2)25-12-8-5-9-13-25/h4-17,22-23,31H,3,18-21H2,1-2H3,(H,30,34)/b17-14+/t23-/m0/s1 |
| InChIKey | JIVFUCFRGURYLO-IOUNIBQOSA-N |
| XLogP | 4.52 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|