C25H37N5O3S — CID 93018912
1-butyl-3-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]urea (PubChem CID 93018912) has the molecular formula C25H37N5O3S and a molecular weight of 487.67 g/mol. Its IUPAC name is 1-butyl-3-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]urea.
| Compound Name | 1-butyl-3-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 93018912 |
| Molecular Formula | C25H37N5O3S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 1-butyl-3-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]urea |
| SMILES | CCCCNC(=O)Nc1ccc(N2CCN(CC)CC2)c(S(=O)(=O)N[C@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H37N5O3S/c1-4-6-14-26-25(31)27-22-12-13-23(30-17-15-29(5-2)16-18-30)24(19-22)34(32,33)28-20(3)21-10-8-7-9-11-21/h7-13,19-20,28H,4-6,14-18H2,1-3H3,(H2,26,27,31)/t20-/m1/s1 |
| InChIKey | OWIAGUVIWBZRFG-HXUWFJFHSA-N |
| XLogP | 3.79 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|