C19H22N2O4S — CID 99979248
3-[[(1S)-1-phenylethyl]sulfamoyl]-4-pyrrolidin-1-ylbenzoic acid (PubChem CID 99979248) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 3-[[(1S)-1-phenylethyl]sulfamoyl]-4-pyrrolidin-1-ylbenzoic acid.
| Compound Name | 3-[[(1S)-1-phenylethyl]sulfamoyl]-4-pyrrolidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 99979248 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 3-[[(1S)-1-phenylethyl]sulfamoyl]-4-pyrrolidin-1-ylbenzoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1cc(C(=O)O)ccc1N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-14(15-7-3-2-4-8-15)20-26(24,25)18-13-16(19(22)23)9-10-17(18)21-11-5-6-12-21/h2-4,7-10,13-14,20H,5-6,11-12H2,1H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | AVZVJJCDJPWFBN-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |