C26H33N3O5S — CID 46110458
ethyl 1-[4-(cyclopropanecarbonylamino)-2-(1-phenylethylsulfamoyl)phenyl]piperidine-3-carboxylate (PubChem CID 46110458) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is ethyl 1-[4-(cyclopropanecarbonylamino)-2-(1-phenylethylsulfamoyl)phenyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-(cyclopropanecarbonylamino)-2-(1-phenylethylsulfamoyl)phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46110458 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | ethyl 1-[4-(cyclopropanecarbonylamino)-2-(1-phenylethylsulfamoyl)phenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ccc(NC(=O)C3CC3)cc2S(=O)(=O)NC(C)c2ccccc2)C1 |
| InChI | InChI=1S/C26H33N3O5S/c1-3-34-26(31)21-10-7-15-29(17-21)23-14-13-22(27-25(30)20-11-12-20)16-24(23)35(32,33)28-18(2)19-8-5-4-6-9-19/h4-6,8-9,13-14,16,18,20-21,28H,3,7,10-12,15,17H2,1-2H3,(H,27,30) |
| InChIKey | FAQFBOWISVWZEN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|