C28H32N4O5S — CID 42882175
1-[4-[(2-phenoxyacetyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 42882175) has the molecular formula C28H32N4O5S and a molecular weight of 536.65 g/mol. Its IUPAC name is 1-[4-[(2-phenoxyacetyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[(2-phenoxyacetyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42882175 |
| Molecular Formula | C28H32N4O5S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 1-[4-[(2-phenoxyacetyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(NS(=O)(=O)c1cc(NC(=O)COc2ccccc2)ccc1N1CCC(C(N)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O5S/c1-20(21-8-4-2-5-9-21)31-38(35,36)26-18-23(30-27(33)19-37-24-10-6-3-7-11-24)12-13-25(26)32-16-14-22(15-17-32)28(29)34/h2-13,18,20,22,31H,14-17,19H2,1H3,(H2,29,34)(H,30,33) |
| InChIKey | KCPIICMXVCXCBO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|