C29H36N4O4S — CID 98197924
N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]-2-methylpropanamide (PubChem CID 98197924) has the molecular formula C29H36N4O4S and a molecular weight of 536.70 g/mol. Its IUPAC name is N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 98197924 |
| Molecular Formula | C29H36N4O4S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]-2-methylpropanamide |
| SMILES | COc1ccc(N2CCN(c3ccc(NC(=O)C(C)C)cc3S(=O)(=O)N[C@H](C)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H36N4O4S/c1-21(2)29(34)30-24-10-15-27(28(20-24)38(35,36)31-22(3)23-8-6-5-7-9-23)33-18-16-32(17-19-33)25-11-13-26(37-4)14-12-25/h5-15,20-22,31H,16-19H2,1-4H3,(H,30,34)/t22-/m1/s1 |
| InChIKey | GBTHNCYKARDFED-JOCHJYFZSA-N |
| XLogP | 4.66 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|