C35H38N4O4 — CID 3903131
2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)-5-[(2-phenylmethoxyacetyl)amino]benzamide (PubChem CID 3903131) has the molecular formula C35H38N4O4 and a molecular weight of 578.71 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)-5-[(2-phenylmethoxyacetyl)amino]benzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)-5-[(2-phenylmethoxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 3903131 |
| Molecular Formula | C35H38N4O4 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)-5-[(2-phenylmethoxyacetyl)amino]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)COCc3ccccc3)cc2C(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C35H38N4O4/c1-26(28-13-7-4-8-14-28)36-35(41)30-23-29(37-34(40)25-43-24-27-11-5-3-6-12-27)17-18-31(30)38-19-21-39(22-20-38)32-15-9-10-16-33(32)42-2/h3-18,23,26H,19-22,24-25H2,1-2H3,(H,36,41)(H,37,40) |
| InChIKey | KCINGAVUPCTIFC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|