C26H35N3O7S — CID 46110216
ethyl 4-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylanilino]-4-oxobutanoate (PubChem CID 46110216) has the molecular formula C26H35N3O7S and a molecular weight of 533.65 g/mol. Its IUPAC name is ethyl 4-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylanilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylanilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 46110216 |
| Molecular Formula | C26H35N3O7S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | ethyl 4-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylanilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc(N2CCCC2)c(S(=O)(=O)NCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C26H35N3O7S/c1-4-36-26(31)12-11-25(30)28-20-8-9-21(29-15-5-6-16-29)24(18-20)37(32,33)27-14-13-19-7-10-22(34-2)23(17-19)35-3/h7-10,17-18,27H,4-6,11-16H2,1-3H3,(H,28,30) |
| InChIKey | XHYKHIUEQMTYQV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|