C20H29N3O4 — CID 42751125
ethyl 4-oxo-4-[3-(propan-2-ylcarbamoyl)-4-pyrrolidin-1-ylanilino]butanoate (PubChem CID 42751125) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 4-oxo-4-[3-(propan-2-ylcarbamoyl)-4-pyrrolidin-1-ylanilino]butanoate.
| Compound Name | ethyl 4-oxo-4-[3-(propan-2-ylcarbamoyl)-4-pyrrolidin-1-ylanilino]butanoate |
|---|---|
| PubChem CID | 42751125 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | ethyl 4-oxo-4-[3-(propan-2-ylcarbamoyl)-4-pyrrolidin-1-ylanilino]butanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc(N2CCCC2)c(C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C20H29N3O4/c1-4-27-19(25)10-9-18(24)22-15-7-8-17(23-11-5-6-12-23)16(13-15)20(26)21-14(2)3/h7-8,13-14H,4-6,9-12H2,1-3H3,(H,21,26)(H,22,24) |
| InChIKey | IFRQSXSVPFATRC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|