C31H36N4O6S — CID 46110528
1-[2-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]piperidine-4-carboxamide (PubChem CID 46110528) has the molecular formula C31H36N4O6S and a molecular weight of 592.72 g/mol. Its IUPAC name is 1-[2-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46110528 |
| Molecular Formula | C31H36N4O6S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 1-[2-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2cc(NC(=O)/C=C/c3ccccc3)ccc2N2CCC(C(N)=O)CC2)cc1OC |
| InChI | InChI=1S/C31H36N4O6S/c1-40-27-12-8-23(20-28(27)41-2)14-17-33-42(38,39)29-21-25(34-30(36)13-9-22-6-4-3-5-7-22)10-11-26(29)35-18-15-24(16-19-35)31(32)37/h3-13,20-21,24,33H,14-19H2,1-2H3,(H2,32,37)(H,34,36)/b13-9+ |
| InChIKey | WXYNDFIVDBNWRX-UKTHLTGXSA-N |
| XLogP | 3.58 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|