C15H15Cl2NO4S — CID 17375973
N-[(3,4-dichlorophenyl)methyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 17375973) has the molecular formula C15H15Cl2NO4S and a molecular weight of 376.26 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 17375973 |
| Molecular Formula | C15H15Cl2NO4S |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(Cl)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C15H15Cl2NO4S/c1-21-11-4-6-15(14(8-11)22-2)23(19,20)18-9-10-3-5-12(16)13(17)7-10/h3-8,18H,9H2,1-2H3 |
| InChIKey | UEKNRUUENHUVRT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |