C13H16N2O4S — CID 110782771
2,4-dimethoxy-N-(1H-pyrrol-3-ylmethyl)benzenesulfonamide (PubChem CID 110782771) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(1H-pyrrol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-(1H-pyrrol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110782771 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,4-dimethoxy-N-(1H-pyrrol-3-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2cc[nH]c2)c(OC)c1 |
| InChI | InChI=1S/C13H16N2O4S/c1-18-11-3-4-13(12(7-11)19-2)20(16,17)15-9-10-5-6-14-8-10/h3-8,14-15H,9H2,1-2H3 |
| InChIKey | ACUPLPIGQZLLGW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |