C12H14N2O5S — CID 110719005
2,4-dimethoxy-N-(1,3-oxazol-4-ylmethyl)benzenesulfonamide (PubChem CID 110719005) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(1,3-oxazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-(1,3-oxazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110719005 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2,4-dimethoxy-N-(1,3-oxazol-4-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2cocn2)c(OC)c1 |
| InChI | InChI=1S/C12H14N2O5S/c1-17-10-3-4-12(11(5-10)18-2)20(15,16)14-6-9-7-19-8-13-9/h3-5,7-8,14H,6H2,1-2H3 |
| InChIKey | IODYELIVMKCNCJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |