C14H17N3O3S — CID 60914928
2-amino-4-methoxy-N-(2-pyridin-4-ylethyl)benzenesulfonamide (PubChem CID 60914928) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-amino-4-methoxy-N-(2-pyridin-4-ylethyl)benzenesulfonamide.
| Compound Name | 2-amino-4-methoxy-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60914928 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-amino-4-methoxy-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2ccncc2)c(N)c1 |
| InChI | InChI=1S/C14H17N3O3S/c1-20-12-2-3-14(13(15)10-12)21(18,19)17-9-6-11-4-7-16-8-5-11/h2-5,7-8,10,17H,6,9,15H2,1H3 |
| InChIKey | QRATVMSKVPJJEC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|