C23H25NO4S — CID 90497565
2-ethoxy-N-[2-hydroxy-2-(4-phenylphenyl)propyl]benzenesulfonamide (PubChem CID 90497565) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is 2-ethoxy-N-[2-hydroxy-2-(4-phenylphenyl)propyl]benzenesulfonamide.
| Compound Name | 2-ethoxy-N-[2-hydroxy-2-(4-phenylphenyl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90497565 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-ethoxy-N-[2-hydroxy-2-(4-phenylphenyl)propyl]benzenesulfonamide |
| SMILES | CCOc1ccccc1S(=O)(=O)NCC(C)(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO4S/c1-3-28-21-11-7-8-12-22(21)29(26,27)24-17-23(2,25)20-15-13-19(14-16-20)18-9-5-4-6-10-18/h4-16,24-25H,3,17H2,1-2H3 |
| InChIKey | BRNQQTKFYLZYIU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |