C24H26N2O4 — CID 90497665
1-(2,4-dimethoxyphenyl)-3-[2-hydroxy-2-(4-phenylphenyl)propyl]urea (PubChem CID 90497665) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[2-hydroxy-2-(4-phenylphenyl)propyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[2-hydroxy-2-(4-phenylphenyl)propyl]urea |
|---|---|
| PubChem CID | 90497665 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[2-hydroxy-2-(4-phenylphenyl)propyl]urea |
| SMILES | COc1ccc(NC(=O)NCC(C)(O)c2ccc(-c3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H26N2O4/c1-24(28,19-11-9-18(10-12-19)17-7-5-4-6-8-17)16-25-23(27)26-21-14-13-20(29-2)15-22(21)30-3/h4-15,28H,16H2,1-3H3,(H2,25,26,27) |
| InChIKey | LXPSVVOCMYCRLF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |