C19H29N3O — CID 120873764
3-amino-1-(2-benzyl-2,8-diazaspiro[4.5]decan-8-yl)butan-1-one (PubChem CID 120873764) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-amino-1-(2-benzyl-2,8-diazaspiro[4.5]decan-8-yl)butan-1-one.
| Compound Name | 3-amino-1-(2-benzyl-2,8-diazaspiro[4.5]decan-8-yl)butan-1-one |
|---|---|
| PubChem CID | 120873764 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 3-amino-1-(2-benzyl-2,8-diazaspiro[4.5]decan-8-yl)butan-1-one |
| SMILES | CC(N)CC(=O)N1CCC2(CCN(Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C19H29N3O/c1-16(20)13-18(23)22-11-8-19(9-12-22)7-10-21(15-19)14-17-5-3-2-4-6-17/h2-6,16H,7-15,20H2,1H3 |
| InChIKey | MZRVQLYKWCHBAW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |