C22H27F6N7O2 — CID 122549424
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-methyl-2-[4-(2H-tetrazol-5-yl)piperidin-1-yl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 122549424) has the molecular formula C22H27F6N7O2 and a molecular weight of 535.49 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-methyl-2-[4-(2H-tetrazol-5-yl)piperidin-1-yl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-methyl-2-[4-(2H-tetrazol-5-yl)piperidin-1-yl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122549424 |
| Molecular Formula | C22H27F6N7O2 |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-methyl-2-[4-(2H-tetrazol-5-yl)piperidin-1-yl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(N2CCC(c3nn[nH]n3)CC2)c1 |
| InChI | InChI=1S/C22H27F6N7O2/c1-14-2-3-16(17(12-14)34-6-4-15(5-7-34)18-29-31-32-30-18)13-33-8-10-35(11-9-33)20(36)37-19(21(23,24)25)22(26,27)28/h2-3,12,15,19H,4-11,13H2,1H3,(H,29,30,31,32) |
| InChIKey | UKIMTYOTRLTBQI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |