C21H24F9N3O3 — CID 71657077
1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-methyl-4-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 71657077) has the molecular formula C21H24F9N3O3 and a molecular weight of 537.42 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-methyl-4-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-methyl-4-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71657077 |
| Molecular Formula | C21H24F9N3O3 |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (2S)-2-methyl-4-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | C[C@H]1CN(Cc2ccc(N3CCOCC3)cc2C(F)(F)F)CCN1C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H24F9N3O3/c1-13-11-31(4-5-33(13)18(34)36-17(20(25,26)27)21(28,29)30)12-14-2-3-15(10-16(14)19(22,23)24)32-6-8-35-9-7-32/h2-3,10,13,17H,4-9,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | XPYNPNBKCDLNEB-ZDUSSCGKSA-N |
| XLogP | 4.68 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|