C23H29F3N4O5 — CID 71744391
(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 71744391) has the molecular formula C23H29F3N4O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71744391 |
| Molecular Formula | C23H29F3N4O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC1(C)CN(Cc2ccc(N3CCOCC3)cc2C(F)(F)F)CCN1C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C23H29F3N4O5/c1-22(2)15-27(7-8-29(22)21(33)35-30-19(31)5-6-20(30)32)14-16-3-4-17(13-18(16)23(24,25)26)28-9-11-34-12-10-28/h3-4,13H,5-12,14-15H2,1-2H3 |
| InChIKey | KJHBRWWXPMZIRC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|