C22H27ClN4O5 — CID 90468013
(2,5-dioxopyrrolidin-1-yl) 2-[(2-chloro-4-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 90468013) has the molecular formula C22H27ClN4O5 and a molecular weight of 462.93 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(2-chloro-4-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2-chloro-4-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90468013 |
| Molecular Formula | C22H27ClN4O5 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2-chloro-4-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)N1CC2CN(Cc3ccc(N4CCOCC4)cc3Cl)CC2C1 |
| InChI | InChI=1S/C22H27ClN4O5/c23-19-9-18(25-5-7-31-8-6-25)2-1-15(19)10-24-11-16-13-26(14-17(16)12-24)22(30)32-27-20(28)3-4-21(27)29/h1-2,9,16-17H,3-8,10-14H2 |
| InChIKey | GPJKZOXKVVIPID-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|