C21H25ClN4O4 — CID 123708800
(2,5-dihydroxypyrrol-1-yl) 2-[[2-(azetidin-1-yl)-4-chlorophenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 123708800) has the molecular formula C21H25ClN4O4 and a molecular weight of 432.91 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[[2-(azetidin-1-yl)-4-chlorophenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[[2-(azetidin-1-yl)-4-chlorophenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 123708800 |
| Molecular Formula | C21H25ClN4O4 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[[2-(azetidin-1-yl)-4-chlorophenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(On1c(O)ccc1O)N1CC2CN(Cc3ccc(Cl)cc3N3CCC3)CC2C1 |
| InChI | InChI=1S/C21H25ClN4O4/c22-17-3-2-14(18(8-17)24-6-1-7-24)9-23-10-15-12-25(13-16(15)11-23)21(29)30-26-19(27)4-5-20(26)28/h2-5,8,15-16,27-28H,1,6-7,9-13H2 |
| InChIKey | OXEZRNJJKHZYCM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |