C22H28ClN5O2 — CID 161040237
[2-[(4-chloro-2-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-methylpyrazol-1-yl)methanone (PubChem CID 161040237) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is [2-[(4-chloro-2-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-methylpyrazol-1-yl)methanone.
| Compound Name | [2-[(4-chloro-2-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-methylpyrazol-1-yl)methanone |
|---|---|
| PubChem CID | 161040237 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [2-[(4-chloro-2-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-methylpyrazol-1-yl)methanone |
| SMILES | Cc1cnn(C(=O)N2CC3CN(Cc4ccc(Cl)cc4N4CCOCC4)CC3C2)c1 |
| InChI | InChI=1S/C22H28ClN5O2/c1-16-9-24-28(10-16)22(29)27-14-18-12-25(13-19(18)15-27)11-17-2-3-20(23)8-21(17)26-4-6-30-7-5-26/h2-3,8-10,18-19H,4-7,11-15H2,1H3 |
| InChIKey | JMWQIUFLOIOHFZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |