C23H27F3N6O3 — CID 139417592
1-[2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-4-carboxamide (PubChem CID 139417592) has the molecular formula C23H27F3N6O3 and a molecular weight of 492.50 g/mol. Its IUPAC name is 1-[2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-4-carboxamide.
| Compound Name | 1-[2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139417592 |
| Molecular Formula | C23H27F3N6O3 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 1-[2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(C(=O)N2CC3CN(Cc4ccc(N5CCOCC5)cc4C(F)(F)F)CC3C2)c1 |
| InChI | InChI=1S/C23H27F3N6O3/c24-23(25,26)20-7-19(30-3-5-35-6-4-30)2-1-15(20)9-29-10-17-12-31(13-18(17)11-29)22(34)32-14-16(8-28-32)21(27)33/h1-2,7-8,14,17-18H,3-6,9-13H2,(H2,27,33) |
| InChIKey | UNRDQVZIGBWJKM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|