C24H32N6O3 — CID 135375463
N-methyl-N-[1-[2-[(3-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]acetamide (PubChem CID 135375463) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-methyl-N-[1-[2-[(3-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]acetamide.
| Compound Name | N-methyl-N-[1-[2-[(3-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 135375463 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-methyl-N-[1-[2-[(3-morpholin-4-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]acetamide |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2CC3CN(Cc4cccc(N5CCOCC5)c4)CC3C2)c1 |
| InChI | InChI=1S/C24H32N6O3/c1-18(31)26(2)23-11-25-30(17-23)24(32)29-15-20-13-27(14-21(20)16-29)12-19-4-3-5-22(10-19)28-6-8-33-9-7-28/h3-5,10-11,17,20-21H,6-9,12-16H2,1-2H3 |
| InChIKey | IVKDQGOCQFBKOL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |