C22H30N6O2 — CID 135375904
N-methyl-N-[1-[4-[(4-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carbonyl]pyrazol-4-yl]acetamide (PubChem CID 135375904) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-methyl-N-[1-[4-[(4-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carbonyl]pyrazol-4-yl]acetamide.
| Compound Name | N-methyl-N-[1-[4-[(4-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carbonyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 135375904 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-methyl-N-[1-[4-[(4-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carbonyl]pyrazol-4-yl]acetamide |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2CCN(Cc3ccc(N4CCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C22H30N6O2/c1-18(29)24(2)21-15-23-28(17-21)22(30)27-13-11-25(12-14-27)16-19-5-7-20(8-6-19)26-9-3-4-10-26/h5-8,15,17H,3-4,9-14,16H2,1-2H3 |
| InChIKey | ZITRWENYFWVPEH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|