C17H20ClN5O2 — CID 118526909
1-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-N-methylpyrazole-4-carboxamide (PubChem CID 118526909) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-N-methylpyrazole-4-carboxamide.
| Compound Name | 1-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-N-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118526909 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-N-methylpyrazole-4-carboxamide |
| SMILES | CNC(=O)c1cnn(C(=O)N2CCN(Cc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C17H20ClN5O2/c1-19-16(24)14-10-20-23(12-14)17(25)22-8-6-21(7-9-22)11-13-2-4-15(18)5-3-13/h2-5,10,12H,6-9,11H2,1H3,(H,19,24) |
| InChIKey | ZDWCWRPTEFKZSN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |