C19H24N6O3 — CID 118526485
morpholin-4-yl-[1-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]pyrazol-4-yl]methanone (PubChem CID 118526485) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is morpholin-4-yl-[1-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]pyrazol-4-yl]methanone.
| Compound Name | morpholin-4-yl-[1-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 118526485 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | morpholin-4-yl-[1-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]pyrazol-4-yl]methanone |
| SMILES | O=C(c1cnn(C(=O)N2CCN(Cc3ccncc3)CC2)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H24N6O3/c26-18(23-9-11-28-12-10-23)17-13-21-25(15-17)19(27)24-7-5-22(6-8-24)14-16-1-3-20-4-2-16/h1-4,13,15H,5-12,14H2 |
| InChIKey | IQWSVQZBKDDNGN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |