C18H23N7O3 — CID 118526844
morpholin-4-yl-[1-[4-(pyrimidin-4-ylmethyl)piperazine-1-carbonyl]pyrazol-4-yl]methanone (PubChem CID 118526844) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is morpholin-4-yl-[1-[4-(pyrimidin-4-ylmethyl)piperazine-1-carbonyl]pyrazol-4-yl]methanone.
| Compound Name | morpholin-4-yl-[1-[4-(pyrimidin-4-ylmethyl)piperazine-1-carbonyl]pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 118526844 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | morpholin-4-yl-[1-[4-(pyrimidin-4-ylmethyl)piperazine-1-carbonyl]pyrazol-4-yl]methanone |
| SMILES | O=C(c1cnn(C(=O)N2CCN(Cc3ccncn3)CC2)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H23N7O3/c26-17(23-7-9-28-10-8-23)15-11-21-25(12-15)18(27)24-5-3-22(4-6-24)13-16-1-2-19-14-20-16/h1-2,11-12,14H,3-10,13H2 |
| InChIKey | UILGTWBDXSXIRB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 96.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |