C19H23N7O3 — CID 123301378
2-[4-(morpholine-4-carbonyl)pyrazol-1-yl]-2-[4-(pyrimidin-5-ylmethyl)piperazin-1-yl]ethenone (PubChem CID 123301378) has the molecular formula C19H23N7O3 and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-[4-(morpholine-4-carbonyl)pyrazol-1-yl]-2-[4-(pyrimidin-5-ylmethyl)piperazin-1-yl]ethenone.
| Compound Name | 2-[4-(morpholine-4-carbonyl)pyrazol-1-yl]-2-[4-(pyrimidin-5-ylmethyl)piperazin-1-yl]ethenone |
|---|---|
| PubChem CID | 123301378 |
| Molecular Formula | C19H23N7O3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[4-(morpholine-4-carbonyl)pyrazol-1-yl]-2-[4-(pyrimidin-5-ylmethyl)piperazin-1-yl]ethenone |
| SMILES | O=C=C(N1CCN(Cc2cncnc2)CC1)n1cc(C(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C19H23N7O3/c27-14-18(24-3-1-23(2-4-24)12-16-9-20-15-21-10-16)26-13-17(11-22-26)19(28)25-5-7-29-8-6-25/h9-11,13,15H,1-8,12H2 |
| InChIKey | UJLFSOABGMNRKI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 96.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|