C24H32N6O2 — CID 135375972
N-methyl-N-[1-[2-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]acetamide (PubChem CID 135375972) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-methyl-N-[1-[2-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]acetamide.
| Compound Name | N-methyl-N-[1-[2-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 135375972 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N-methyl-N-[1-[2-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]acetamide |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2CC3CN(Cc4ccccc4N4CCCC4)CC3C2)c1 |
| InChI | InChI=1S/C24H32N6O2/c1-18(31)26(2)22-11-25-30(17-22)24(32)29-15-20-13-27(14-21(20)16-29)12-19-7-3-4-8-23(19)28-9-5-6-10-28/h3-4,7-8,11,17,20-21H,5-6,9-10,12-16H2,1-2H3 |
| InChIKey | MFUUHKUZJHLSSV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |