C24H26ClN7O3 — CID 135375556
N-[1-[2-[(2-chloro-4-pyrimidin-5-yloxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide (PubChem CID 135375556) has the molecular formula C24H26ClN7O3 and a molecular weight of 495.97 g/mol. Its IUPAC name is N-[1-[2-[(2-chloro-4-pyrimidin-5-yloxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide.
| Compound Name | N-[1-[2-[(2-chloro-4-pyrimidin-5-yloxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 135375556 |
| Molecular Formula | C24H26ClN7O3 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[1-[2-[(2-chloro-4-pyrimidin-5-yloxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2CC3CN(Cc4ccc(Oc5cncnc5)cc4Cl)CC3C2)c1 |
| InChI | InChI=1S/C24H26ClN7O3/c1-16(33)29(2)20-6-28-32(14-20)24(34)31-12-18-10-30(11-19(18)13-31)9-17-3-4-21(5-23(17)25)35-22-7-26-15-27-8-22/h3-8,14-15,18-19H,9-13H2,1-2H3 |
| InChIKey | MKDOAWKQMONYDN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |