C24H30ClN7O2 — CID 145315957
N-[1-[2-[[2-chloro-4-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide (PubChem CID 145315957) has the molecular formula C24H30ClN7O2 and a molecular weight of 484.00 g/mol. Its IUPAC name is N-[1-[2-[[2-chloro-4-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide.
| Compound Name | N-[1-[2-[[2-chloro-4-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 145315957 |
| Molecular Formula | C24H30ClN7O2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-[1-[2-[[2-chloro-4-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2CC3CN(Cc4ccc(/C(N)=C/C=C\N)cc4Cl)CC3C2)c1 |
| InChI | InChI=1S/C24H30ClN7O2/c1-16(33)29(2)21-9-28-32(15-21)24(34)31-13-19-11-30(12-20(19)14-31)10-18-6-5-17(8-22(18)25)23(27)4-3-7-26/h3-9,15,19-20H,10-14,26-27H2,1-2H3/b7-3-,23-4- |
| InChIKey | YQNQTEUELNOAME-FHDAOAHBSA-N |
| XLogP | 2.32 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|