C22H28Cl2N5O2+ — CID 145315970
[(3aR,6aS)-2-[4-[acetyl(methyl)amino]pyrazole-1-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-[(2,5-dichlorophenyl)methyl]-methylazanium (PubChem CID 145315970) has the molecular formula C22H28Cl2N5O2+ and a molecular weight of 465.41 g/mol. Its IUPAC name is [(3aR,6aS)-2-[4-[acetyl(methyl)amino]pyrazole-1-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-[(2,5-dichlorophenyl)methyl]-methylazanium.
| Compound Name | [(3aR,6aS)-2-[4-[acetyl(methyl)amino]pyrazole-1-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-[(2,5-dichlorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 145315970 |
| Molecular Formula | C22H28Cl2N5O2+ |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [(3aR,6aS)-2-[4-[acetyl(methyl)amino]pyrazole-1-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-[(2,5-dichlorophenyl)methyl]-methylazanium |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2C[C@H]3CC([NH+](C)Cc4cc(Cl)ccc4Cl)C[C@H]3C2)c1 |
| InChI | InChI=1S/C22H27Cl2N5O2/c1-14(30)27(3)20-9-25-29(13-20)22(31)28-11-15-7-19(8-16(15)12-28)26(2)10-17-6-18(23)4-5-21(17)24/h4-6,9,13,15-16,19H,7-8,10-12H2,1-3H3/p+1/t15-,16+,19? |
| InChIKey | IUZYHPWQRIKNMP-MCPYQZEQSA-O |
| XLogP | 2.57 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |