C20H23ClF3N5O — CID 145315953
(4-aminopyrazol-1-yl)-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl-methylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methanone (PubChem CID 145315953) has the molecular formula C20H23ClF3N5O and a molecular weight of 441.89 g/mol. Its IUPAC name is (4-aminopyrazol-1-yl)-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl-methylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methanone.
| Compound Name | (4-aminopyrazol-1-yl)-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl-methylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 145315953 |
| Molecular Formula | C20H23ClF3N5O |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (4-aminopyrazol-1-yl)-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl-methylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methanone |
| SMILES | CN(Cc1cc(Cl)ccc1C(F)(F)F)C1CC2CN(C(=O)n3cc(N)cn3)CC2C1 |
| InChI | InChI=1S/C20H23ClF3N5O/c1-27(8-14-4-15(21)2-3-18(14)20(22,23)24)17-5-12-9-28(10-13(12)6-17)19(30)29-11-16(25)7-26-29/h2-4,7,11-13,17H,5-6,8-10,25H2,1H3 |
| InChIKey | CTZUAKKDNMVCHN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |