C22H27F3N6O — CID 145316160
(4-aminopyrazol-1-yl)-[2-[[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 145316160) has the molecular formula C22H27F3N6O and a molecular weight of 448.49 g/mol. Its IUPAC name is (4-aminopyrazol-1-yl)-[2-[[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (4-aminopyrazol-1-yl)-[2-[[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 145316160 |
| Molecular Formula | C22H27F3N6O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (4-aminopyrazol-1-yl)-[2-[[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Nc1cnn(C(=O)N2CC3CN(Cc4ccc(N5CCCC5)cc4C(F)(F)F)CC3C2)c1 |
| InChI | InChI=1S/C22H27F3N6O/c23-22(24,25)20-7-19(29-5-1-2-6-29)4-3-15(20)9-28-10-16-12-30(13-17(16)11-28)21(32)31-14-18(26)8-27-31/h3-4,7-8,14,16-17H,1-2,5-6,9-13,26H2 |
| InChIKey | GDFQSSDZSXASJT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|