C22H29N5O — CID 157335876
(4-methylpyrazol-1-yl)-[2-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 157335876) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is (4-methylpyrazol-1-yl)-[2-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (4-methylpyrazol-1-yl)-[2-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 157335876 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (4-methylpyrazol-1-yl)-[2-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1cnn(C(=O)N2CC3CN(Cc4ccccc4N4CCCC4)CC3C2)c1 |
| InChI | InChI=1S/C22H29N5O/c1-17-10-23-27(11-17)22(28)26-15-19-13-24(14-20(19)16-26)12-18-6-2-3-7-21(18)25-8-4-5-9-25/h2-3,6-7,10-11,19-20H,4-5,8-9,12-16H2,1H3 |
| InChIKey | FKXXKDBVTBPPDL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |