C18H22ClN5O3S — CID 135375930
N-[1-[2-[(2-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]methanesulfonamide (PubChem CID 135375930) has the molecular formula C18H22ClN5O3S and a molecular weight of 423.93 g/mol. Its IUPAC name is N-[1-[2-[(2-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]methanesulfonamide.
| Compound Name | N-[1-[2-[(2-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 135375930 |
| Molecular Formula | C18H22ClN5O3S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[1-[2-[(2-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cnn(C(=O)N2CC3CN(Cc4ccccc4Cl)CC3C2)c1 |
| InChI | InChI=1S/C18H22ClN5O3S/c1-28(26,27)21-16-6-20-24(12-16)18(25)23-10-14-8-22(9-15(14)11-23)7-13-4-2-3-5-17(13)19/h2-6,12,14-15,21H,7-11H2,1H3 |
| InChIKey | WJQNJURFKGPYHF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |