C18H20Cl2N4O — CID 145315865
[(3aR)-5-[(2-chlorophenyl)methylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-chloropyrazol-1-yl)methanone (PubChem CID 145315865) has the molecular formula C18H20Cl2N4O and a molecular weight of 379.29 g/mol. Its IUPAC name is [(3aR)-5-[(2-chlorophenyl)methylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-chloropyrazol-1-yl)methanone.
| Compound Name | [(3aR)-5-[(2-chlorophenyl)methylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-chloropyrazol-1-yl)methanone |
|---|---|
| PubChem CID | 145315865 |
| Molecular Formula | C18H20Cl2N4O |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [(3aR)-5-[(2-chlorophenyl)methylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-chloropyrazol-1-yl)methanone |
| SMILES | O=C(N1CC2CC(NCc3ccccc3Cl)C[C@H]2C1)n1cc(Cl)cn1 |
| InChI | InChI=1S/C18H20Cl2N4O/c19-15-8-22-24(11-15)18(25)23-9-13-5-16(6-14(13)10-23)21-7-12-3-1-2-4-17(12)20/h1-4,8,11,13-14,16,21H,5-7,9-10H2/t13-,14?,16?/m0/s1 |
| InChIKey | QEPUIXPPUXLIBY-HLIUYOAVSA-N |
| XLogP | 3.66 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |