C22H25ClN6OS — CID 145315974
[2-[[2-chloro-4-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone (PubChem CID 145315974) has the molecular formula C22H25ClN6OS and a molecular weight of 457.00 g/mol. Its IUPAC name is [2-[[2-chloro-4-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone.
| Compound Name | [2-[[2-chloro-4-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 145315974 |
| Molecular Formula | C22H25ClN6OS |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [2-[[2-chloro-4-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)pyrazol-1-yl]methanone |
| SMILES | CN(C)c1cnn(C(=O)N2CC3CN(Cc4ccc(-c5nccs5)cc4Cl)CC3C2)c1 |
| InChI | InChI=1S/C22H25ClN6OS/c1-26(2)19-8-25-29(14-19)22(30)28-12-17-10-27(11-18(17)13-28)9-16-4-3-15(7-20(16)23)21-24-5-6-31-21/h3-8,14,17-18H,9-13H2,1-2H3 |
| InChIKey | UPXZJVLUUCZQQQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |