C23H25ClN6O2S — CID 135375814
N-[1-[2-[[2-chloro-4-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide (PubChem CID 135375814) has the molecular formula C23H25ClN6O2S and a molecular weight of 485.01 g/mol. Its IUPAC name is N-[1-[2-[[2-chloro-4-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide.
| Compound Name | N-[1-[2-[[2-chloro-4-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 135375814 |
| Molecular Formula | C23H25ClN6O2S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-[1-[2-[[2-chloro-4-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2CC3CN(Cc4ccc(-c5nccs5)cc4Cl)CC3C2)c1 |
| InChI | InChI=1S/C23H25ClN6O2S/c1-15(31)27(2)20-8-26-30(14-20)23(32)29-12-18-10-28(11-19(18)13-29)9-17-4-3-16(7-21(17)24)22-25-5-6-33-22/h3-8,14,18-19H,9-13H2,1-2H3 |
| InChIKey | WXUHEQIPXJQTPL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |