C22H30ClN5O — CID 145315861
[2-[[4-chloro-2-(diethylamino)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-methylpyrazol-1-yl)methanone (PubChem CID 145315861) has the molecular formula C22H30ClN5O and a molecular weight of 415.97 g/mol. Its IUPAC name is [2-[[4-chloro-2-(diethylamino)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-methylpyrazol-1-yl)methanone.
| Compound Name | [2-[[4-chloro-2-(diethylamino)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-methylpyrazol-1-yl)methanone |
|---|---|
| PubChem CID | 145315861 |
| Molecular Formula | C22H30ClN5O |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | [2-[[4-chloro-2-(diethylamino)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(4-methylpyrazol-1-yl)methanone |
| SMILES | CCN(CC)c1cc(Cl)ccc1CN1CC2CN(C(=O)n3cc(C)cn3)CC2C1 |
| InChI | InChI=1S/C22H30ClN5O/c1-4-26(5-2)21-8-20(23)7-6-17(21)11-25-12-18-14-27(15-19(18)13-25)22(29)28-10-16(3)9-24-28/h6-10,18-19H,4-5,11-15H2,1-3H3 |
| InChIKey | DSRPQTZOXNUAOD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |