C18H17Cl3N4O3 — CID 166964800
3-chloro-1-[2-[(2,5-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-4-carboxylic acid (PubChem CID 166964800) has the molecular formula C18H17Cl3N4O3 and a molecular weight of 443.72 g/mol. Its IUPAC name is 3-chloro-1-[2-[(2,5-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-4-carboxylic acid.
| Compound Name | 3-chloro-1-[2-[(2,5-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166964800 |
| Molecular Formula | C18H17Cl3N4O3 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 3-chloro-1-[2-[(2,5-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C(=O)N2CC3CN(Cc4cc(Cl)ccc4Cl)CC3C2)nc1Cl |
| InChI | InChI=1S/C18H17Cl3N4O3/c19-13-1-2-15(20)10(3-13)4-23-5-11-7-24(8-12(11)6-23)18(28)25-9-14(17(26)27)16(21)22-25/h1-3,9,11-12H,4-8H2,(H,26,27) |
| InChIKey | ILZQNAGKBXOIBI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |