C25H22ClF3N4O4 — CID 135384839
1-[2-[[3-(4-chlorophenoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid (PubChem CID 135384839) has the molecular formula C25H22ClF3N4O4 and a molecular weight of 534.92 g/mol. Its IUPAC name is 1-[2-[[3-(4-chlorophenoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-[[3-(4-chlorophenoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 135384839 |
| Molecular Formula | C25H22ClF3N4O4 |
| Molecular Weight | 534.92 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 1-[2-[[3-(4-chlorophenoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(C(=O)N2CC3CN(Cc4cccc(Oc5ccc(Cl)cc5)c4)CC3C2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H22ClF3N4O4/c26-18-4-6-19(7-5-18)37-20-3-1-2-15(8-20)9-31-10-16-12-32(13-17(16)11-31)24(36)33-14-21(25(27,28)29)22(30-33)23(34)35/h1-8,14,16-17H,9-13H2,(H,34,35) |
| InChIKey | WDSZNWWNDKUYNH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |