C20H22F3N5O3 — CID 142483019
N-[1-[2-[[3-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-3-yl]acetamide (PubChem CID 142483019) has the molecular formula C20H22F3N5O3 and a molecular weight of 437.42 g/mol. Its IUPAC name is N-[1-[2-[[3-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-3-yl]acetamide.
| Compound Name | N-[1-[2-[[3-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 142483019 |
| Molecular Formula | C20H22F3N5O3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[1-[2-[[3-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccn(C(=O)N2CC3CN(Cc4cccc(OC(F)(F)F)c4)CC3C2)n1 |
| InChI | InChI=1S/C20H22F3N5O3/c1-13(29)24-18-5-6-28(25-18)19(30)27-11-15-9-26(10-16(15)12-27)8-14-3-2-4-17(7-14)31-20(21,22)23/h2-7,15-16H,8-12H2,1H3,(H,24,25,29) |
| InChIKey | VCMKPHHKRVVMIS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |