C25H22F3N3O4 — CID 138563101
1-[(3aR,6aS)-5-(3-phenylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid (PubChem CID 138563101) has the molecular formula C25H22F3N3O4 and a molecular weight of 485.46 g/mol. Its IUPAC name is 1-[(3aR,6aS)-5-(3-phenylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid.
| Compound Name | 1-[(3aR,6aS)-5-(3-phenylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 138563101 |
| Molecular Formula | C25H22F3N3O4 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 1-[(3aR,6aS)-5-(3-phenylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]-4-(trifluoromethyl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(C(=O)N2C[C@H]3CC(Oc4cccc(-c5ccccc5)c4)C[C@H]3C2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H22F3N3O4/c26-25(27,28)21-14-31(29-22(21)23(32)33)24(34)30-12-17-10-20(11-18(17)13-30)35-19-8-4-7-16(9-19)15-5-2-1-3-6-15/h1-9,14,17-18,20H,10-13H2,(H,32,33)/t17-,18+,20? |
| InChIKey | NKIIJGQEMAGNMT-UFRUDQCGSA-N |
| XLogP | 5.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |