C18H17ClFN3O4 — CID 138563093
1-[(3aS,6aR)-5-(3-chloro-5-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid (PubChem CID 138563093) has the molecular formula C18H17ClFN3O4 and a molecular weight of 393.80 g/mol. Its IUPAC name is 1-[(3aS,6aR)-5-(3-chloro-5-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[(3aS,6aR)-5-(3-chloro-5-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 138563093 |
| Molecular Formula | C18H17ClFN3O4 |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-[(3aS,6aR)-5-(3-chloro-5-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(C(=O)N2C[C@H]3CC(Oc4cc(F)cc(Cl)c4)C[C@H]3C2)n1 |
| InChI | InChI=1S/C18H17ClFN3O4/c19-12-5-13(20)7-15(6-12)27-14-3-10-8-22(9-11(10)4-14)18(26)23-2-1-16(21-23)17(24)25/h1-2,5-7,10-11,14H,3-4,8-9H2,(H,24,25)/t10-,11+,14? |
| InChIKey | IRZPKGVTAKMKEF-BVUQATHDSA-N |
| XLogP | 3.13 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |