C24H29N3O4 — CID 160707859
1-[1-[(3aS,6aR)-5-[2-(oxan-4-yl)phenoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazol-3-yl]ethanone (PubChem CID 160707859) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-[1-[(3aS,6aR)-5-[2-(oxan-4-yl)phenoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazol-3-yl]ethanone.
| Compound Name | 1-[1-[(3aS,6aR)-5-[2-(oxan-4-yl)phenoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazol-3-yl]ethanone |
|---|---|
| PubChem CID | 160707859 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-[1-[(3aS,6aR)-5-[2-(oxan-4-yl)phenoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazol-3-yl]ethanone |
| SMILES | CC(=O)c1ccn(C(=O)N2C[C@H]3CC(Oc4ccccc4C4CCOCC4)C[C@H]3C2)n1 |
| InChI | InChI=1S/C24H29N3O4/c1-16(28)22-6-9-27(25-22)24(29)26-14-18-12-20(13-19(18)15-26)31-23-5-3-2-4-21(23)17-7-10-30-11-8-17/h2-6,9,17-20H,7-8,10-15H2,1H3/t18-,19+,20? |
| InChIKey | UJVYEBDBJCBGDM-YOFSQIOKSA-N |
| XLogP | 3.74 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |