C23H27N3O4 — CID 138563071
1-[(3aS,6aR)-5-(3-cyclopentylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid (PubChem CID 138563071) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-[(3aS,6aR)-5-(3-cyclopentylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[(3aS,6aR)-5-(3-cyclopentylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 138563071 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-[(3aS,6aR)-5-(3-cyclopentylphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(C(=O)N2C[C@H]3CC(Oc4cccc(C5CCCC5)c4)C[C@H]3C2)n1 |
| InChI | InChI=1S/C23H27N3O4/c27-22(28)21-8-9-26(24-21)23(29)25-13-17-11-20(12-18(17)14-25)30-19-7-3-6-16(10-19)15-4-1-2-5-15/h3,6-10,15,17-18,20H,1-2,4-5,11-14H2,(H,27,28)/t17-,18+,20? |
| InChIKey | YUJAHBXANORUSP-UFRUDQCGSA-N |
| XLogP | 4.00 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |